C24H22F2N2O6S — CID 118285572
(3R,3aR,6R,6aR)-6-[[5-[4-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)phenyl]-4,6-difluoro-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118285572) has the molecular formula C24H22F2N2O6S and a molecular weight of 504.51 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[5-[4-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)phenyl]-4,6-difluoro-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[5-[4-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)phenyl]-4,6-difluoro-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118285572 |
| Molecular Formula | C24H22F2N2O6S |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[5-[4-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)phenyl]-4,6-difluoro-1H-benzimidazol-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O=S1(=O)CC=C(c2ccc(-c3c(F)cc4[nH]c(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)nc4c3F)cc2)CC1 |
| InChI | InChI=1S/C24H22F2N2O6S/c25-15-9-16-21(28-24(27-16)34-18-11-33-22-17(29)10-32-23(18)22)20(26)19(15)14-3-1-12(2-4-14)13-5-7-35(30,31)8-6-13/h1-5,9,17-18,22-23,29H,6-8,10-11H2,(H,27,28)/t17-,18-,22-,23-/m1/s1 |
| InChIKey | UMRDDNMPKQSEBK-DPZOUVDISA-N |
| XLogP | 2.62 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |