C32H38O6S2 — CID 118285706
6,17-bis(heptylsulfonyl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14(19),15,17-nonaene (PubChem CID 118285706) has the molecular formula C32H38O6S2 and a molecular weight of 582.78 g/mol. Its IUPAC name is 6,17-bis(heptylsulfonyl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14(19),15,17-nonaene.
| Compound Name | 6,17-bis(heptylsulfonyl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 118285706 |
| Molecular Formula | C32H38O6S2 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 6,17-bis(heptylsulfonyl)-3,20-dioxapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14(19),15,17-nonaene |
| SMILES | CCCCCCCS(=O)(=O)c1ccc2c(c1)oc1c2ccc2c3ccc(S(=O)(=O)CCCCCCC)cc3oc21 |
| InChI | InChI=1S/C32H38O6S2/c1-3-5-7-9-11-19-39(33,34)23-13-15-25-27-17-18-28-26-16-14-24(40(35,36)20-12-10-8-6-4-2)22-30(26)38-32(28)31(27)37-29(25)21-23/h13-18,21-22H,3-12,19-20H2,1-2H3 |
| InChIKey | FMTTXUNZKMUIFT-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 94.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|