About 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one
4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one (PubChem CID 118286065) has the molecular formula C11H8ClF2NO
and a molecular weight of 243.64 g/mol. Its IUPAC name is 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one.
Molecular Properties
| Compound Name | 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one |
| PubChem CID | 118286065 |
| Molecular Formula | C11H8ClF2NO |
| Molecular Weight | 243.64 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one |
| SMILES | O=C1C=C(c2c(F)ccc(Cl)c2F)CCN1 |
| InChI | InChI=1S/C11H8ClF2NO/c12-7-1-2-8(13)10(11(7)14)6-3-4-15-9(16)5-6/h1-2,5H,3-4H2,(H,15,16) |
| InChIKey | IUDWDIUUHXLWQD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one?
The IUPAC name of 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one (CID 118286065) is 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one.
What is the SMILES notation for 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one?
The canonical SMILES for 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one is O=C1C=C(c2c(F)ccc(Cl)c2F)CCN1.
What is the InChIKey of 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one?
The InChIKey is IUDWDIUUHXLWQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClF2NO/c12-7-1-2-8(13)10(11(7)14)6-3-4-15-9(16)5-6/h1-2,5H,3-4H2,(H,15,16).
What are the key properties of 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one?
4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one has a molecular weight of 243.64 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloro-2,6-difluorophenyl)-2,3-dihydro-1H-pyridin-6-one is sourced from PubChem (CID 118286065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).