C23H31N7O2S — CID 118286095
N-[2-(1H-indol-3-yl)-1-(propylcarbamoylamino)ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide (PubChem CID 118286095) has the molecular formula C23H31N7O2S and a molecular weight of 469.62 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-1-(propylcarbamoylamino)ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)-1-(propylcarbamoylamino)ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 118286095 |
| Molecular Formula | C23H31N7O2S |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-1-(propylcarbamoylamino)ethyl]-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCNC(=O)NC(Cc1c[nH]c2ccccc12)NC(=O)c1cnc(N2CCN(C)CC2)s1 |
| InChI | InChI=1S/C23H31N7O2S/c1-3-8-24-22(32)28-20(13-16-14-25-18-7-5-4-6-17(16)18)27-21(31)19-15-26-23(33-19)30-11-9-29(2)10-12-30/h4-7,14-15,20,25H,3,8-13H2,1-2H3,(H,27,31)(H2,24,28,32) |
| InChIKey | GAWRKDDKGVZEKL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|