C14H20O4 — CID 118286794
2-(4,4-dihydroxy-2-methylbutan-2-yl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 118286794) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-(4,4-dihydroxy-2-methylbutan-2-yl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(4,4-dihydroxy-2-methylbutan-2-yl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 118286794 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(4,4-dihydroxy-2-methylbutan-2-yl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(C(C)(C)CC(O)O)=C(C)C1=O |
| InChI | InChI=1S/C14H20O4/c1-7-8(2)13(18)11(9(3)12(7)17)14(4,5)6-10(15)16/h10,15-16H,6H2,1-5H3 |
| InChIKey | WAHLKEFTDKTGGG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|