C29H37N3 — CID 118286891
N,N-diethyl-4-[(Z)-[4-[ethyl(propyl)amino]phenyl]-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline (PubChem CID 118286891) has the molecular formula C29H37N3 and a molecular weight of 427.64 g/mol. Its IUPAC name is N,N-diethyl-4-[(Z)-[4-[ethyl(propyl)amino]phenyl]-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline.
| Compound Name | N,N-diethyl-4-[(Z)-[4-[ethyl(propyl)amino]phenyl]-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline |
|---|---|
| PubChem CID | 118286891 |
| Molecular Formula | C29H37N3 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.30 |
| IUPAC Name | N,N-diethyl-4-[(Z)-[4-[ethyl(propyl)amino]phenyl]-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline |
| SMILES | [H]/N=C1\C=C/C(=C(\c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CCC)cc2)C=C1C |
| InChI | InChI=1S/C29H37N3/c1-6-20-32(9-4)27-17-12-24(13-18-27)29(25-14-19-28(30)22(5)21-25)23-10-15-26(16-11-23)31(7-2)8-3/h10-19,21,30H,6-9,20H2,1-5H3/b29-25-,30-28+ |
| InChIKey | QAHSAPTYNZQZJJ-NUJMRUCPSA-N |
| XLogP | 7.11 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|