C40H41N3O11 — CID 11828719
2-[4-[2-acetamido-3-[4-(3-hydroxy-2-methoxycarbonyl-4-phenylphenoxy)butylamino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid (PubChem CID 11828719) has the molecular formula C40H41N3O11 and a molecular weight of 739.78 g/mol. Its IUPAC name is 2-[4-[2-acetamido-3-[4-(3-hydroxy-2-methoxycarbonyl-4-phenylphenoxy)butylamino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid.
| Compound Name | 2-[4-[2-acetamido-3-[4-(3-hydroxy-2-methoxycarbonyl-4-phenylphenoxy)butylamino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
|---|---|
| PubChem CID | 11828719 |
| Molecular Formula | C40H41N3O11 |
| Molecular Weight | 739.78 g/mol |
| Exact Mass | 739.27 |
| IUPAC Name | 2-[4-[2-acetamido-3-[4-(3-hydroxy-2-methoxycarbonyl-4-phenylphenoxy)butylamino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
| SMILES | CCc1cc(CC(NC(C)=O)C(=O)NCCCCOc2ccc(-c3ccccc3)c(O)c2C(=O)OC)ccc1N(C(=O)C(=O)O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C40H41N3O11/c1-4-26-22-25(16-18-31(26)43(37(47)39(50)51)32-15-9-8-14-29(32)38(48)49)23-30(42-24(2)44)36(46)41-20-10-11-21-54-33-19-17-28(27-12-6-5-7-13-27)35(45)34(33)40(52)53-3/h5-9,12-19,22,30,45H,4,10-11,20-21,23H2,1-3H3,(H,41,46)(H,42,44)(H,48,49)(H,50,51) |
| InChIKey | MATPDXBXMLXXPY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 208.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.78 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|