C24H35N2O6P — CID 118287332
dibutyl [(3R,4S)-6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] phosphate (PubChem CID 118287332) has the molecular formula C24H35N2O6P and a molecular weight of 478.53 g/mol. Its IUPAC name is dibutyl [(3R,4S)-6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] phosphate.
| Compound Name | dibutyl [(3R,4S)-6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] phosphate |
|---|---|
| PubChem CID | 118287332 |
| Molecular Formula | C24H35N2O6P |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | dibutyl [(3R,4S)-6-cyano-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-3,4-dihydrochromen-3-yl] phosphate |
| SMILES | CCCCOP(=O)(OCCCC)O[C@@H]1[C@@H](N2CCCC2=O)c2cc(C#N)ccc2OC1(C)C |
| InChI | InChI=1S/C24H35N2O6P/c1-5-7-14-29-33(28,30-15-8-6-2)32-23-22(26-13-9-10-21(26)27)19-16-18(17-25)11-12-20(19)31-24(23,3)4/h11-12,16,22-23H,5-10,13-15H2,1-4H3/t22-,23+/m0/s1 |
| InChIKey | SPUWHPSFVSGBEF-XZOQPEGZSA-N |
| XLogP | 5.52 |
| TPSA | 98.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|