C36H52N4O4+2 — CID 11828771
[2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[dimethyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]azaniumyl]hexyl]-dimethylazanium (PubChem CID 11828771) has the molecular formula C36H52N4O4+2 and a molecular weight of 604.84 g/mol. Its IUPAC name is [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[dimethyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]azaniumyl]hexyl]-dimethylazanium.
| Compound Name | [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[dimethyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]azaniumyl]hexyl]-dimethylazanium |
|---|---|
| PubChem CID | 11828771 |
| Molecular Formula | C36H52N4O4+2 |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.40 |
| IUPAC Name | [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[dimethyl-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]azaniumyl]hexyl]-dimethylazanium |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC[N+](C)(C)CCCCCC[N+](C)(C)CC(C)(C)CN1C(=O)c3ccc(C)cc3C1=O)C2=O |
| InChI | InChI=1S/C36H52N4O4/c1-26-14-16-28-30(22-26)34(43)37(32(28)41)18-13-21-39(5,6)19-11-9-10-12-20-40(7,8)25-36(3,4)24-38-33(42)29-17-15-27(2)23-31(29)35(38)44/h14-17,22-23H,9-13,18-21,24-25H2,1-8H3/q+2 |
| InChIKey | RSROAIOJNNDQFH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|