C12H19N3O — CID 118287830
(4R,5R,6S)-5-(methoxymethyl)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene (PubChem CID 118287830) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is (4R,5R,6S)-5-(methoxymethyl)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene.
| Compound Name | (4R,5R,6S)-5-(methoxymethyl)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
|---|---|
| PubChem CID | 118287830 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (4R,5R,6S)-5-(methoxymethyl)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
| SMILES | COC[C@@H]1[C@@H]2CCc3c(nnn3C)CC[C@@H]21 |
| InChI | InChI=1S/C12H19N3O/c1-15-12-6-4-9-8(10(9)7-16-2)3-5-11(12)13-14-15/h8-10H,3-7H2,1-2H3/t8-,9+,10-/m0/s1 |
| InChIKey | KOPZBKRMWSBROV-AEJSXWLSSA-N |
| XLogP | 1.20 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |