C12H20N4 — CID 118287831
N-methyl-1-[(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine (PubChem CID 118287831) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is N-methyl-1-[(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine.
| Compound Name | N-methyl-1-[(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine |
|---|---|
| PubChem CID | 118287831 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | N-methyl-1-[(4R,5R,6S)-12-methyl-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-dien-5-yl]methanamine |
| SMILES | CNC[C@@H]1[C@@H]2CCc3c(nnn3C)CC[C@@H]21 |
| InChI | InChI=1S/C12H20N4/c1-13-7-10-8-3-5-11-12(6-4-9(8)10)16(2)15-14-11/h8-10,13H,3-7H2,1-2H3/t8-,9+,10-/m0/s1 |
| InChIKey | YESRPUBJQJUUAW-AEJSXWLSSA-N |
| XLogP | 0.78 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |