C20H19N5O — CID 118288272
11-[(1-methyl-4-phenylimidazol-2-yl)methoxy]-1,7,12-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 118288272) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 11-[(1-methyl-4-phenylimidazol-2-yl)methoxy]-1,7,12-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 11-[(1-methyl-4-phenylimidazol-2-yl)methoxy]-1,7,12-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 118288272 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 11-[(1-methyl-4-phenylimidazol-2-yl)methoxy]-1,7,12-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | Cn1cc(-c2ccccc2)nc1COc1ccc2nc3c(n2n1)CCC3 |
| InChI | InChI=1S/C20H19N5O/c1-24-12-16(14-6-3-2-4-7-14)22-19(24)13-26-20-11-10-18-21-15-8-5-9-17(15)25(18)23-20/h2-4,6-7,10-12H,5,8-9,13H2,1H3 |
| InChIKey | UMFVDPMHCFJPCE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |