C5H6F4N2O — CID 118288673
4,4,5,5-tetrafluoro-1,3-dimethylimidazolidin-2-one (PubChem CID 118288673) has the molecular formula C5H6F4N2O and a molecular weight of 186.11 g/mol. Its IUPAC name is 4,4,5,5-tetrafluoro-1,3-dimethylimidazolidin-2-one.
| Compound Name | 4,4,5,5-tetrafluoro-1,3-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 118288673 |
| Molecular Formula | C5H6F4N2O |
| Molecular Weight | 186.11 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 4,4,5,5-tetrafluoro-1,3-dimethylimidazolidin-2-one |
| SMILES | CN1C(=O)N(C)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5H6F4N2O/c1-10-3(12)11(2)5(8,9)4(10,6)7/h1-2H3 |
| InChIKey | QBRPBZOUWLUGBY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.11 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|