About 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole
5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole (PubChem CID 118288747) has the molecular formula C9H11ClF2N4O2
and a molecular weight of 280.66 g/mol. Its IUPAC name is 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole.
Molecular Properties
| Compound Name | 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole |
| PubChem CID | 118288747 |
| Molecular Formula | C9H11ClF2N4O2 |
| Molecular Weight | 280.66 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole |
| SMILES | O=[N+]([O-])c1cnn([C@H]2CCN(CC(F)F)C2)c1Cl |
| InChI | InChI=1S/C9H11ClF2N4O2/c10-9-7(16(17)18)3-13-15(9)6-1-2-14(4-6)5-8(11)12/h3,6,8H,1-2,4-5H2/t6-/m0/s1 |
| InChIKey | MFNVTIHUVCIQBQ-LURJTMIESA-N |
| XLogP | 1.96 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.66 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole?
The IUPAC name of 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole (CID 118288747) is 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole.
What is the SMILES notation for 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole?
The canonical SMILES for 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole is O=[N+]([O-])c1cnn([C@H]2CCN(CC(F)F)C2)c1Cl.
What is the InChIKey of 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole?
The InChIKey is MFNVTIHUVCIQBQ-LURJTMIESA-N. The full InChI is InChI=1S/C9H11ClF2N4O2/c10-9-7(16(17)18)3-13-15(9)6-1-2-14(4-6)5-8(11)12/h3,6,8H,1-2,4-5H2/t6-/m0/s1.
What are the key properties of 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole?
5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole has a molecular weight of 280.66 g/mol, XLogP of 1.96, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-4-nitropyrazole is sourced from PubChem (CID 118288747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).