C17H17F3N4O — CID 118288752
N-[[3-[5-(trifluoromethyl)pyrazin-2-yl]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 118288752) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is N-[[3-[5-(trifluoromethyl)pyrazin-2-yl]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[[3-[5-(trifluoromethyl)pyrazin-2-yl]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118288752 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[[3-[5-(trifluoromethyl)pyrazin-2-yl]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1cccc(-c2cnc(C(F)(F)F)cn2)c1)C1CCCN1 |
| InChI | InChI=1S/C17H17F3N4O/c18-17(19,20)15-10-22-14(9-23-15)12-4-1-3-11(7-12)8-24-16(25)13-5-2-6-21-13/h1,3-4,7,9-10,13,21H,2,5-6,8H2,(H,24,25) |
| InChIKey | NUXFCBWZAYQYGF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |