About 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole
1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole (PubChem CID 118288756) has the molecular formula C10H14F2N4O2
and a molecular weight of 260.24 g/mol. Its IUPAC name is 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole.
Molecular Properties
| Compound Name | 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole |
| PubChem CID | 118288756 |
| Molecular Formula | C10H14F2N4O2 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole |
| SMILES | Cc1c([N+](=O)[O-])cnn1[C@H]1CCN(CC(F)F)C1 |
| InChI | InChI=1S/C10H14F2N4O2/c1-7-9(16(17)18)4-13-15(7)8-2-3-14(5-8)6-10(11)12/h4,8,10H,2-3,5-6H2,1H3/t8-/m0/s1 |
| InChIKey | RJLJKKRLTNZGIJ-QMMMGPOBSA-N |
| XLogP | 1.61 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole?
The IUPAC name of 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole (CID 118288756) is 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole.
What is the SMILES notation for 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole?
The canonical SMILES for 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole is Cc1c([N+](=O)[O-])cnn1[C@H]1CCN(CC(F)F)C1.
What is the InChIKey of 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole?
The InChIKey is RJLJKKRLTNZGIJ-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H14F2N4O2/c1-7-9(16(17)18)4-13-15(7)8-2-3-14(5-8)6-10(11)12/h4,8,10H,2-3,5-6H2,1H3/t8-/m0/s1.
What are the key properties of 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole?
1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole has a molecular weight of 260.24 g/mol, XLogP of 1.61, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-1-(2,2-difluoroethyl)pyrrolidin-3-yl]-5-methyl-4-nitropyrazole is sourced from PubChem (CID 118288756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).