About 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine
1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine (PubChem CID 118288782) has the molecular formula C10H16F2N4
and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine.
Molecular Properties
| Compound Name | 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine |
| PubChem CID | 118288782 |
| Molecular Formula | C10H16F2N4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine |
| SMILES | Cc1c(N)cnn1[C@H]1CCN[C@@H](C(F)F)C1 |
| InChI | InChI=1S/C10H16F2N4/c1-6-8(13)5-15-16(6)7-2-3-14-9(4-7)10(11)12/h5,7,9-10,14H,2-4,13H2,1H3/t7-,9+/m0/s1 |
| InChIKey | QTMKRELWUKRBLH-IONNQARKSA-N |
| XLogP | 1.33 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine?
The IUPAC name of 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine (CID 118288782) is 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine.
What is the SMILES notation for 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine?
The canonical SMILES for 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine is Cc1c(N)cnn1[C@H]1CCN[C@@H](C(F)F)C1.
What is the InChIKey of 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine?
The InChIKey is QTMKRELWUKRBLH-IONNQARKSA-N. The full InChI is InChI=1S/C10H16F2N4/c1-6-8(13)5-15-16(6)7-2-3-14-9(4-7)10(11)12/h5,7,9-10,14H,2-4,13H2,1H3/t7-,9+/m0/s1.
What are the key properties of 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine?
1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine has a molecular weight of 230.26 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R,4S)-2-(difluoromethyl)piperidin-4-yl]-5-methylpyrazol-4-amine is sourced from PubChem (CID 118288782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).