C11H16ClFN4O — CID 118288846
5-chloro-1-[3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]pyrazol-4-amine (PubChem CID 118288846) has the molecular formula C11H16ClFN4O and a molecular weight of 274.73 g/mol. Its IUPAC name is 5-chloro-1-[3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]pyrazol-4-amine.
| Compound Name | 5-chloro-1-[3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]pyrazol-4-amine |
|---|---|
| PubChem CID | 118288846 |
| Molecular Formula | C11H16ClFN4O |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 5-chloro-1-[3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]pyrazol-4-amine |
| SMILES | Nc1cnn(C2CCN(C3COC3)CC2F)c1Cl |
| InChI | InChI=1S/C11H16ClFN4O/c12-11-9(14)3-15-17(11)10-1-2-16(4-8(10)13)7-5-18-6-7/h3,7-8,10H,1-2,4-6,14H2 |
| InChIKey | HAVZARVPJOGOSJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |