About 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole
1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole (PubChem CID 118288971) has the molecular formula C13H19F2N3O3
and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole.
Molecular Properties
| Compound Name | 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole |
| PubChem CID | 118288971 |
| Molecular Formula | C13H19F2N3O3 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole |
| SMILES | CCCCOC1CCC(F)(F)C(n2cc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C13H19F2N3O3/c1-2-3-6-21-11-4-5-13(14,15)12(7-11)17-9-10(8-16-17)18(19)20/h8-9,11-12H,2-7H2,1H3 |
| InChIKey | RRGNBTJWWKJDGR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole?
The IUPAC name of 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole (CID 118288971) is 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole.
What is the SMILES notation for 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole?
The canonical SMILES for 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole is CCCCOC1CCC(F)(F)C(n2cc([N+](=O)[O-])cn2)C1.
What is the InChIKey of 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole?
The InChIKey is RRGNBTJWWKJDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2N3O3/c1-2-3-6-21-11-4-5-13(14,15)12(7-11)17-9-10(8-16-17)18(19)20/h8-9,11-12H,2-7H2,1H3.
What are the key properties of 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole?
1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole has a molecular weight of 303.31 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-butoxy-2,2-difluorocyclohexyl)-4-nitropyrazole is sourced from PubChem (CID 118288971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).