About tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate
tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate (PubChem CID 118288982) has the molecular formula C14H20F2N4O4
and a molecular weight of 346.33 g/mol. Its IUPAC name is tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate |
| PubChem CID | 118288982 |
| Molecular Formula | C14H20F2N4O4 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate |
| SMILES | Cc1c([N+](=O)[O-])cnn1C1CCN(C(=O)OC(C)(C)C)CC1(F)F |
| InChI | InChI=1S/C14H20F2N4O4/c1-9-10(20(22)23)7-17-19(9)11-5-6-18(8-14(11,15)16)12(21)24-13(2,3)4/h7,11H,5-6,8H2,1-4H3 |
| InChIKey | XTVVKNWKYLJJQI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate (CID 118288982) is tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate is Cc1c([N+](=O)[O-])cnn1C1CCN(C(=O)OC(C)(C)C)CC1(F)F.
What is the InChIKey of tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate?
The InChIKey is XTVVKNWKYLJJQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N4O4/c1-9-10(20(22)23)7-17-19(9)11-5-6-18(8-14(11,15)16)12(21)24-13(2,3)4/h7,11H,5-6,8H2,1-4H3.
What are the key properties of tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate?
tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate has a molecular weight of 346.33 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,3-difluoro-4-(5-methyl-4-nitropyrazol-1-yl)piperidine-1-carboxylate is sourced from PubChem (CID 118288982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).