C7H10F6N2O — CID 118289412
1,3-dimethyl-1,3-bis(2,2,2-trifluoroethyl)urea (PubChem CID 118289412) has the molecular formula C7H10F6N2O and a molecular weight of 252.16 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-bis(2,2,2-trifluoroethyl)urea.
| Compound Name | 1,3-dimethyl-1,3-bis(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 118289412 |
| Molecular Formula | C7H10F6N2O |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1,3-dimethyl-1,3-bis(2,2,2-trifluoroethyl)urea |
| SMILES | CN(CC(F)(F)F)C(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C7H10F6N2O/c1-14(3-6(8,9)10)5(16)15(2)4-7(11,12)13/h3-4H2,1-2H3 |
| InChIKey | PELNOZKPOVWCBU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |