About 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one
4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 118289611) has the molecular formula C20H15F2N5O
and a molecular weight of 379.37 g/mol. Its IUPAC name is 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 118289611 |
| Molecular Formula | C20H15F2N5O |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cn1c(=O)c(-c2c(F)cccc2F)cc2c(N)nc(Nc3ccccc3)nc21 |
| InChI | InChI=1S/C20H15F2N5O/c1-27-18-13(10-12(19(27)28)16-14(21)8-5-9-15(16)22)17(23)25-20(26-18)24-11-6-3-2-4-7-11/h2-10H,1H3,(H3,23,24,25,26) |
| InChIKey | QTPHYOKRTHHFQX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one (CID 118289611) is 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one is Cn1c(=O)c(-c2c(F)cccc2F)cc2c(N)nc(Nc3ccccc3)nc21.
What is the InChIKey of 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one?
The InChIKey is QTPHYOKRTHHFQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2N5O/c1-27-18-13(10-12(19(27)28)16-14(21)8-5-9-15(16)22)17(23)25-20(26-18)24-11-6-3-2-4-7-11/h2-10H,1H3,(H3,23,24,25,26).
What are the key properties of 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one?
4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one has a molecular weight of 379.37 g/mol, XLogP of 3.60, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-anilino-6-(2,6-difluorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 118289611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).