C18H19Cl2N5O — CID 118289621
2-amino-6-(2,6-dichlorophenyl)-4-(pentylamino)-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 118289621) has the molecular formula C18H19Cl2N5O and a molecular weight of 392.29 g/mol. Its IUPAC name is 2-amino-6-(2,6-dichlorophenyl)-4-(pentylamino)-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-amino-6-(2,6-dichlorophenyl)-4-(pentylamino)-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 118289621 |
| Molecular Formula | C18H19Cl2N5O |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-amino-6-(2,6-dichlorophenyl)-4-(pentylamino)-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCCCNc1nc(N)nc2[nH]c(=O)c(-c3c(Cl)cccc3Cl)cc12 |
| InChI | InChI=1S/C18H19Cl2N5O/c1-2-3-4-8-22-15-11-9-10(14-12(19)6-5-7-13(14)20)17(26)23-16(11)25-18(21)24-15/h5-7,9H,2-4,8H2,1H3,(H4,21,22,23,24,25,26) |
| InChIKey | OOSXURBLTNFQEK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|