C21H20N2O6 — CID 118289789
4-[3-[(3-hydroxy-1-methyl-2-oxoquinoline-4-carbonyl)amino]propoxy]benzoic acid (PubChem CID 118289789) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 4-[3-[(3-hydroxy-1-methyl-2-oxoquinoline-4-carbonyl)amino]propoxy]benzoic acid.
| Compound Name | 4-[3-[(3-hydroxy-1-methyl-2-oxoquinoline-4-carbonyl)amino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 118289789 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-[3-[(3-hydroxy-1-methyl-2-oxoquinoline-4-carbonyl)amino]propoxy]benzoic acid |
| SMILES | Cn1c(=O)c(O)c(C(=O)NCCCOc2ccc(C(=O)O)cc2)c2ccccc21 |
| InChI | InChI=1S/C21H20N2O6/c1-23-16-6-3-2-5-15(16)17(18(24)20(23)26)19(25)22-11-4-12-29-14-9-7-13(8-10-14)21(27)28/h2-3,5-10,24H,4,11-12H2,1H3,(H,22,25)(H,27,28) |
| InChIKey | NOQCEYKKESKZLW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|