About [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate
[3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate (PubChem CID 118289966) has the molecular formula C32H31N5O2
and a molecular weight of 517.63 g/mol. Its IUPAC name is [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate.
Molecular Properties
| Compound Name | [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate |
| PubChem CID | 118289966 |
| Molecular Formula | C32H31N5O2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate |
| SMILES | Cc1ccc(OC(=O)Nc2ccc(N3CCCN(Cc4ccccc4)CC3)nc2)cc1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C32H31N5O2/c1-24-8-14-29(20-30(24)27-11-9-25(21-33)10-12-27)39-32(38)35-28-13-15-31(34-22-28)37-17-5-16-36(18-19-37)23-26-6-3-2-4-7-26/h2-4,6-15,20,22H,5,16-19,23H2,1H3,(H,35,38) |
| InChIKey | HVKBDJKSTJMQIL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate?
The IUPAC name of [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate (CID 118289966) is [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate.
What is the SMILES notation for [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate?
The canonical SMILES for [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate is Cc1ccc(OC(=O)Nc2ccc(N3CCCN(Cc4ccccc4)CC3)nc2)cc1-c1ccc(C#N)cc1.
What is the InChIKey of [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate?
The InChIKey is HVKBDJKSTJMQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H31N5O2/c1-24-8-14-29(20-30(24)27-11-9-25(21-33)10-12-27)39-32(38)35-28-13-15-31(34-22-28)37-17-5-16-36(18-19-37)23-26-6-3-2-4-7-26/h2-4,6-15,20,22H,5,16-19,23H2,1H3,(H,35,38).
What are the key properties of [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate?
[3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate has a molecular weight of 517.63 g/mol, XLogP of 6.25, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-cyanophenyl)-4-methylphenyl] N-[6-(4-benzyl-1,4-diazepan-1-yl)-3-pyridinyl]carbamate is sourced from PubChem (CID 118289966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).