C25H36N2O3 — CID 118290136
prop-2-enyl N-[[4-(cyclobutylmethoxymethyl)piperidin-4-yl]methyl]-N-[(1R,2S)-2-phenylcyclopropyl]carbamate (PubChem CID 118290136) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is prop-2-enyl N-[[4-(cyclobutylmethoxymethyl)piperidin-4-yl]methyl]-N-[(1R,2S)-2-phenylcyclopropyl]carbamate.
| Compound Name | prop-2-enyl N-[[4-(cyclobutylmethoxymethyl)piperidin-4-yl]methyl]-N-[(1R,2S)-2-phenylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 118290136 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | prop-2-enyl N-[[4-(cyclobutylmethoxymethyl)piperidin-4-yl]methyl]-N-[(1R,2S)-2-phenylcyclopropyl]carbamate |
| SMILES | C=CCOC(=O)N(CC1(COCC2CCC2)CCNCC1)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H36N2O3/c1-2-15-30-24(28)27(23-16-22(23)21-9-4-3-5-10-21)18-25(11-13-26-14-12-25)19-29-17-20-7-6-8-20/h2-5,9-10,20,22-23,26H,1,6-8,11-19H2/t22-,23+/m0/s1 |
| InChIKey | CXVREFRWJPTTQN-XZOQPEGZSA-N |
| XLogP | 4.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|