About 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide
4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide (PubChem CID 118290184) has the molecular formula C20H28N4O
and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide |
| PubChem CID | 118290184 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(CC#N)(CNC2CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C20H28N4O/c1-23(2)19(25)24-12-9-20(8-11-21,10-13-24)15-22-18-14-17(18)16-6-4-3-5-7-16/h3-7,17-18,22H,8-10,12-15H2,1-2H3 |
| InChIKey | HGQDHSUZCOWTMD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide?
The IUPAC name of 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide (CID 118290184) is 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide.
What is the SMILES notation for 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide?
The canonical SMILES for 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide is CN(C)C(=O)N1CCC(CC#N)(CNC2CC2c2ccccc2)CC1.
What is the InChIKey of 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide?
The InChIKey is HGQDHSUZCOWTMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4O/c1-23(2)19(25)24-12-9-20(8-11-21,10-13-24)15-22-18-14-17(18)16-6-4-3-5-7-16/h3-7,17-18,22H,8-10,12-15H2,1-2H3.
What are the key properties of 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide?
4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide has a molecular weight of 340.47 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyanomethyl)-N,N-dimethyl-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxamide is sourced from PubChem (CID 118290184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).