C19H23FO3 — CID 118291103
(4'aS,5'S,8'aS)-8'a-(4-fluorophenyl)-5'-methylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one (PubChem CID 118291103) has the molecular formula C19H23FO3 and a molecular weight of 318.39 g/mol. Its IUPAC name is (4'aS,5'S,8'aS)-8'a-(4-fluorophenyl)-5'-methylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one.
| Compound Name | (4'aS,5'S,8'aS)-8'a-(4-fluorophenyl)-5'-methylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one |
|---|---|
| PubChem CID | 118291103 |
| Molecular Formula | C19H23FO3 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (4'aS,5'S,8'aS)-8'a-(4-fluorophenyl)-5'-methylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one |
| SMILES | C[C@H]1[C@@H]2CCCC(=O)[C@@]2(c2ccc(F)cc2)CCC12OCCO2 |
| InChI | InChI=1S/C19H23FO3/c1-13-16-3-2-4-17(21)18(16,14-5-7-15(20)8-6-14)9-10-19(13)22-11-12-23-19/h5-8,13,16H,2-4,9-12H2,1H3/t13-,16-,18+/m0/s1 |
| InChIKey | DPQQIQOCNVUORI-QANKJYHBSA-N |
| XLogP | 3.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |