C20H23FN2O2 — CID 118291163
(5'aS,6'S,9'aS)-9'a-(3-fluorophenyl)-6'-methylspiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole] (PubChem CID 118291163) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is (5'aS,6'S,9'aS)-9'a-(3-fluorophenyl)-6'-methylspiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole].
| Compound Name | (5'aS,6'S,9'aS)-9'a-(3-fluorophenyl)-6'-methylspiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole] |
|---|---|
| PubChem CID | 118291163 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (5'aS,6'S,9'aS)-9'a-(3-fluorophenyl)-6'-methylspiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole] |
| SMILES | C[C@H]1[C@@H]2CCc3cn[nH]c3[C@@]2(c2cccc(F)c2)CCC12OCCO2 |
| InChI | InChI=1S/C20H23FN2O2/c1-13-17-6-5-14-12-22-23-18(14)19(17,15-3-2-4-16(21)11-15)7-8-20(13)24-9-10-25-20/h2-4,11-13,17H,5-10H2,1H3,(H,22,23)/t13-,17-,19+/m0/s1 |
| InChIKey | MIOKHFSIAFCNHI-SOVGHPHASA-N |
| XLogP | 3.57 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |