C25H24ClN3O — CID 118291184
(6aS,7S,10aS)-2-anilino-4-chloro-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one (PubChem CID 118291184) has the molecular formula C25H24ClN3O and a molecular weight of 417.94 g/mol. Its IUPAC name is (6aS,7S,10aS)-2-anilino-4-chloro-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aS,7S,10aS)-2-anilino-4-chloro-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 118291184 |
| Molecular Formula | C25H24ClN3O |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (6aS,7S,10aS)-2-anilino-4-chloro-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
| SMILES | C[C@@H]1C(=O)CC[C@]2(c3ccccc3)c3nc(Nc4ccccc4)nc(Cl)c3CC[C@@H]12 |
| InChI | InChI=1S/C25H24ClN3O/c1-16-20-13-12-19-22(25(20,15-14-21(16)30)17-8-4-2-5-9-17)28-24(29-23(19)26)27-18-10-6-3-7-11-18/h2-11,16,20H,12-15H2,1H3,(H,27,28,29)/t16-,20-,25+/m0/s1 |
| InChIKey | DNCLSTPIFXQNSV-RGIAPHJHSA-N |
| XLogP | 5.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |