C21H23FN2O2 — CID 118291335
(6'aS,7'S,10'aS)-10'a-(4-fluorophenyl)-7'-methylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] (PubChem CID 118291335) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is (6'aS,7'S,10'aS)-10'a-(4-fluorophenyl)-7'-methylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline].
| Compound Name | (6'aS,7'S,10'aS)-10'a-(4-fluorophenyl)-7'-methylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] |
|---|---|
| PubChem CID | 118291335 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (6'aS,7'S,10'aS)-10'a-(4-fluorophenyl)-7'-methylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] |
| SMILES | C[C@H]1[C@@H]2CCc3cncnc3[C@@]2(c2ccc(F)cc2)CCC12OCCO2 |
| InChI | InChI=1S/C21H23FN2O2/c1-14-18-7-2-15-12-23-13-24-19(15)20(18,16-3-5-17(22)6-4-16)8-9-21(14)25-10-11-26-21/h3-6,12-14,18H,2,7-11H2,1H3/t14-,18-,20+/m0/s1 |
| InChIKey | HMGNRTADEOGEOA-ADLFWFRXSA-N |
| XLogP | 3.64 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |