C28H30N2O3 — CID 118291355
(5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-3-[3-(3-hydroxypropyl)phenyl]-6-methyl-9a-phenyl-1,4,5,5a,6,9-hexahydrobenzo[g]indazol-7-one (PubChem CID 118291355) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is (5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-3-[3-(3-hydroxypropyl)phenyl]-6-methyl-9a-phenyl-1,4,5,5a,6,9-hexahydrobenzo[g]indazol-7-one.
| Compound Name | (5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-3-[3-(3-hydroxypropyl)phenyl]-6-methyl-9a-phenyl-1,4,5,5a,6,9-hexahydrobenzo[g]indazol-7-one |
|---|---|
| PubChem CID | 118291355 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-3-[3-(3-hydroxypropyl)phenyl]-6-methyl-9a-phenyl-1,4,5,5a,6,9-hexahydrobenzo[g]indazol-7-one |
| SMILES | C[C@@H]1C(=O)/C(=C\O)C[C@]2(c3ccccc3)c3[nH]nc(-c4cccc(CCCO)c4)c3CC[C@@H]12 |
| InChI | InChI=1S/C28H30N2O3/c1-18-24-13-12-23-25(20-9-5-7-19(15-20)8-6-14-31)29-30-27(23)28(24,16-21(17-32)26(18)33)22-10-3-2-4-11-22/h2-5,7,9-11,15,17-18,24,31-32H,6,8,12-14,16H2,1H3,(H,29,30)/b21-17-/t18-,24-,28+/m0/s1 |
| InChIKey | OKSCDDMLKHFLFX-ODEDAJSCSA-N |
| XLogP | 4.90 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|