C19H24O3 — CID 118291376
(4'aS,5'S,8'aS)-5'-methyl-8'a-phenylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one (PubChem CID 118291376) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (4'aS,5'S,8'aS)-5'-methyl-8'a-phenylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one.
| Compound Name | (4'aS,5'S,8'aS)-5'-methyl-8'a-phenylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one |
|---|---|
| PubChem CID | 118291376 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (4'aS,5'S,8'aS)-5'-methyl-8'a-phenylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one |
| SMILES | C[C@H]1[C@@H]2CCCC(=O)[C@@]2(c2ccccc2)CCC12OCCO2 |
| InChI | InChI=1S/C19H24O3/c1-14-16-8-5-9-17(20)18(16,15-6-3-2-4-7-15)10-11-19(14)21-12-13-22-19/h2-4,6-7,14,16H,5,8-13H2,1H3/t14-,16-,18+/m0/s1 |
| InChIKey | SGHUDUXFGYATNR-QILLFSRXSA-N |
| XLogP | 3.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |