C20H26O3 — CID 118291500
(4'aS,5'S,8'aR)-8'a-benzyl-5'-methylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one (PubChem CID 118291500) has the molecular formula C20H26O3 and a molecular weight of 314.42 g/mol. Its IUPAC name is (4'aS,5'S,8'aR)-8'a-benzyl-5'-methylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one.
| Compound Name | (4'aS,5'S,8'aR)-8'a-benzyl-5'-methylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one |
|---|---|
| PubChem CID | 118291500 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (4'aS,5'S,8'aR)-8'a-benzyl-5'-methylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one |
| SMILES | C[C@H]1[C@@H]2CCCC(=O)[C@@]2(Cc2ccccc2)CCC12OCCO2 |
| InChI | InChI=1S/C20H26O3/c1-15-17-8-5-9-18(21)19(17,14-16-6-3-2-4-7-16)10-11-20(15)22-12-13-23-20/h2-4,6-7,15,17H,5,8-14H2,1H3/t15-,17-,19+/m0/s1 |
| InChIKey | LAKHMXSTLQWTMD-VDZJLULYSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |