C21H22N2O3 — CID 118291840
(6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-7-methyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one (PubChem CID 118291840) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-7-methyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one.
| Compound Name | (6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-7-methyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 118291840 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-7-methyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one |
| SMILES | COc1ccc([C@]23C/C(=C/O)C(=O)[C@@H](C)[C@@H]2CCc2cncnc23)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-13-18-8-3-14-10-22-12-23-20(14)21(18,9-15(11-24)19(13)25)16-4-6-17(26-2)7-5-16/h4-7,10-13,18,24H,3,8-9H2,1-2H3/b15-11-/t13-,18-,21+/m0/s1 |
| InChIKey | ZHPSWQDMHUHIGZ-LRWBXXSPSA-N |
| XLogP | 3.38 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|