C31H32N4O2 — CID 118291982
(6aS,7S,10aS)-2,7-dimethyl-4-(4-morpholin-4-ylphenyl)-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 118291982) has the molecular formula C31H32N4O2 and a molecular weight of 492.62 g/mol. Its IUPAC name is (6aS,7S,10aS)-2,7-dimethyl-4-(4-morpholin-4-ylphenyl)-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aS,7S,10aS)-2,7-dimethyl-4-(4-morpholin-4-ylphenyl)-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 118291982 |
| Molecular Formula | C31H32N4O2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | (6aS,7S,10aS)-2,7-dimethyl-4-(4-morpholin-4-ylphenyl)-8-oxo-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | Cc1nc(-c2ccc(N3CCOCC3)cc2)c2c(n1)[C@@]1(c3ccccc3)CC(C#N)C(=O)[C@@H](C)[C@@H]1CC2 |
| InChI | InChI=1S/C31H32N4O2/c1-20-27-13-12-26-28(22-8-10-25(11-9-22)35-14-16-37-17-15-35)33-21(2)34-30(26)31(27,18-23(19-32)29(20)36)24-6-4-3-5-7-24/h3-11,20,23,27H,12-18H2,1-2H3/t20-,23?,27-,31+/m0/s1 |
| InChIKey | FQEPMABBURBPOA-FXGDNNORSA-N |
| XLogP | 4.89 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|