C19H17ClF8N6O — CID 118292152
5-chloro-6-[2,6-difluoro-4-[3-(2,2,2-trifluoroethylamino)propoxy]phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 118292152) has the molecular formula C19H17ClF8N6O and a molecular weight of 532.82 g/mol. Its IUPAC name is 5-chloro-6-[2,6-difluoro-4-[3-(2,2,2-trifluoroethylamino)propoxy]phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-[2,6-difluoro-4-[3-(2,2,2-trifluoroethylamino)propoxy]phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 118292152 |
| Molecular Formula | C19H17ClF8N6O |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 5-chloro-6-[2,6-difluoro-4-[3-(2,2,2-trifluoroethylamino)propoxy]phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@H](Nc1c(-c2c(F)cc(OCCCNCC(F)(F)F)cc2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C19H17ClF8N6O/c1-9(19(26,27)28)32-16-14(15(20)33-17-30-8-31-34(16)17)13-11(21)5-10(6-12(13)22)35-4-2-3-29-7-18(23,24)25/h5-6,8-9,29,32H,2-4,7H2,1H3/t9-/m0/s1 |
| InChIKey | QKEMRGMMNKRUOT-VIFPVBQESA-N |
| XLogP | 5.01 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|