About 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile
2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 118292439) has the molecular formula C19H26N4
and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile |
| PubChem CID | 118292439 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | N#CCC1(N2CCC(N[C@H]3C[C@@H]3c3ccccc3)CC2)CNC1 |
| InChI | InChI=1S/C19H26N4/c20-9-8-19(13-21-14-19)23-10-6-16(7-11-23)22-18-12-17(18)15-4-2-1-3-5-15/h1-5,16-18,21-22H,6-8,10-14H2/t17-,18+/m1/s1 |
| InChIKey | XVOKNSJVLHJVLS-MSOLQXFVSA-N |
| XLogP | 1.85 |
| TPSA | 51.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile?
The IUPAC name of 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile (CID 118292439) is 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile.
What is the SMILES notation for 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile?
The canonical SMILES for 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile is N#CCC1(N2CCC(N[C@H]3C[C@@H]3c3ccccc3)CC2)CNC1.
What is the InChIKey of 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile?
The InChIKey is XVOKNSJVLHJVLS-MSOLQXFVSA-N. The full InChI is InChI=1S/C19H26N4/c20-9-8-19(13-21-14-19)23-10-6-16(7-11-23)22-18-12-17(18)15-4-2-1-3-5-15/h1-5,16-18,21-22H,6-8,10-14H2/t17-,18+/m1/s1.
What are the key properties of 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile?
2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile has a molecular weight of 310.44 g/mol, XLogP of 1.85, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-[[(1S,2R)-2-phenylcyclopropyl]amino]piperidin-1-yl]azetidin-3-yl]acetonitrile is sourced from PubChem (CID 118292439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).