C28H36N4O7 — CID 118292588
tert-butyl-[(3S,4S)-7-cyano-4-methyl-1,5-bis(oxane-4-carbonyl)-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]carbamic acid (PubChem CID 118292588) has the molecular formula C28H36N4O7 and a molecular weight of 540.62 g/mol. Its IUPAC name is tert-butyl-[(3S,4S)-7-cyano-4-methyl-1,5-bis(oxane-4-carbonyl)-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(3S,4S)-7-cyano-4-methyl-1,5-bis(oxane-4-carbonyl)-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 118292588 |
| Molecular Formula | C28H36N4O7 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | tert-butyl-[(3S,4S)-7-cyano-4-methyl-1,5-bis(oxane-4-carbonyl)-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]carbamic acid |
| SMILES | C[C@H]1[C@H](N(C(=O)O)C(C)(C)C)C(=O)N(C(=O)C2CCOCC2)c2ccc(C#N)cc2N1C(=O)C1CCOCC1 |
| InChI | InChI=1S/C28H36N4O7/c1-17-23(32(27(36)37)28(2,3)4)26(35)31(25(34)20-9-13-39-14-10-20)21-6-5-18(16-29)15-22(21)30(17)24(33)19-7-11-38-12-8-19/h5-6,15,17,19-20,23H,7-14H2,1-4H3,(H,36,37)/t17-,23-/m0/s1 |
| InChIKey | FZVWMYHZROUNLA-SBUREZEXSA-N |
| XLogP | 3.15 |
| TPSA | 140.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|