C32H40N4O9 — CID 118292736
3-[2-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoic acid (PubChem CID 118292736) has the molecular formula C32H40N4O9 and a molecular weight of 624.69 g/mol. Its IUPAC name is 3-[2-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoic acid.
| Compound Name | 3-[2-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 118292736 |
| Molecular Formula | C32H40N4O9 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | 3-[2-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)CC1(CC(=O)OC(C)(C)C)CC(c2cc(OC(=O)c3ccc(N=C(N)N)cc3)ccc2CCC(=O)O)=NO1 |
| InChI | InChI=1S/C32H40N4O9/c1-30(2,3)43-26(39)17-32(18-27(40)44-31(4,5)6)16-24(36-45-32)23-15-22(13-9-19(23)10-14-25(37)38)42-28(41)20-7-11-21(12-8-20)35-29(33)34/h7-9,11-13,15H,10,14,16-18H2,1-6H3,(H,37,38)(H4,33,34,35) |
| InChIKey | YYLZZVLCYXMOQO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 202.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|