C34H39F3N4O10 — CID 118292737
[3-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[3-oxo-3-(2,2,2-trifluoroacetyl)oxypropyl]phenyl] 4-(diaminomethylideneamino)benzoate (PubChem CID 118292737) has the molecular formula C34H39F3N4O10 and a molecular weight of 720.70 g/mol. Its IUPAC name is [3-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[3-oxo-3-(2,2,2-trifluoroacetyl)oxypropyl]phenyl] 4-(diaminomethylideneamino)benzoate.
| Compound Name | [3-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[3-oxo-3-(2,2,2-trifluoroacetyl)oxypropyl]phenyl] 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 118292737 |
| Molecular Formula | C34H39F3N4O10 |
| Molecular Weight | 720.70 g/mol |
| Exact Mass | 720.26 |
| IUPAC Name | [3-[5,5-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4H-1,2-oxazol-3-yl]-4-[3-oxo-3-(2,2,2-trifluoroacetyl)oxypropyl]phenyl] 4-(diaminomethylideneamino)benzoate |
| SMILES | CC(C)(C)OC(=O)CC1(CC(=O)OC(C)(C)C)CC(c2cc(OC(=O)c3ccc(N=C(N)N)cc3)ccc2CCC(=O)OC(=O)C(F)(F)F)=NO1 |
| InChI | InChI=1S/C34H39F3N4O10/c1-31(2,3)49-26(43)17-33(18-27(44)50-32(4,5)6)16-24(41-51-33)23-15-22(47-28(45)20-7-11-21(12-8-20)40-30(38)39)13-9-19(23)10-14-25(42)48-29(46)34(35,36)37/h7-9,11-13,15H,10,14,16-18H2,1-6H3,(H4,38,39,40) |
| InChIKey | WDXFOXXIWAACRK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 208.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|