C28H27F3N4O8 — CID 118292850
2-[3-[2-cyclohexyl-5-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]-5-(2,2,2-trifluoroacetyl)oxycarbonyl-4H-1,2-oxazol-5-yl]acetic acid (PubChem CID 118292850) has the molecular formula C28H27F3N4O8 and a molecular weight of 604.54 g/mol. Its IUPAC name is 2-[3-[2-cyclohexyl-5-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]-5-(2,2,2-trifluoroacetyl)oxycarbonyl-4H-1,2-oxazol-5-yl]acetic acid.
| Compound Name | 2-[3-[2-cyclohexyl-5-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]-5-(2,2,2-trifluoroacetyl)oxycarbonyl-4H-1,2-oxazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 118292850 |
| Molecular Formula | C28H27F3N4O8 |
| Molecular Weight | 604.54 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | 2-[3-[2-cyclohexyl-5-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]-5-(2,2,2-trifluoroacetyl)oxycarbonyl-4H-1,2-oxazol-5-yl]acetic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc(C3CCCCC3)c(C3=NOC(CC(=O)O)(C(=O)OC(=O)C(F)(F)F)C3)c2)cc1 |
| InChI | InChI=1S/C28H27F3N4O8/c29-28(30,31)25(40)42-24(39)27(14-22(36)37)13-21(35-43-27)20-12-18(10-11-19(20)15-4-2-1-3-5-15)41-23(38)16-6-8-17(9-7-16)34-26(32)33/h6-12,15H,1-5,13-14H2,(H,36,37)(H4,32,33,34) |
| InChIKey | OJHGZNNLOJJPNC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 192.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|