C19H20FN3O — CID 118293837
(2S,5R)-2-[4-(4-fluorophenyl)-2-pyridinyl]-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 118293837) has the molecular formula C19H20FN3O and a molecular weight of 325.39 g/mol. Its IUPAC name is (2S,5R)-2-[4-(4-fluorophenyl)-2-pyridinyl]-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | (2S,5R)-2-[4-(4-fluorophenyl)-2-pyridinyl]-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 118293837 |
| Molecular Formula | C19H20FN3O |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (2S,5R)-2-[4-(4-fluorophenyl)-2-pyridinyl]-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | O=C1NCCC[C@@]12CC[C@@H](c1cc(-c3ccc(F)cc3)ccn1)N2 |
| InChI | InChI=1S/C19H20FN3O/c20-15-4-2-13(3-5-15)14-7-11-21-17(12-14)16-6-9-19(23-16)8-1-10-22-18(19)24/h2-5,7,11-12,16,23H,1,6,8-10H2,(H,22,24)/t16-,19+/m0/s1 |
| InChIKey | OCQOBQSIKGOINR-QFBILLFUSA-N |
| XLogP | 2.96 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |