About 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride
2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride (PubChem CID 118295183) has the molecular formula C12H23ClF2N2O
and a molecular weight of 284.78 g/mol. Its IUPAC name is 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride |
| PubChem CID | 118295183 |
| Molecular Formula | C12H23ClF2N2O |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride |
| SMILES | CC(C)(O)[C@H]1CC(F)(F)CN1C1CCNCC1.Cl |
| InChI | InChI=1S/C12H22F2N2O.ClH/c1-11(2,17)10-7-12(13,14)8-16(10)9-3-5-15-6-4-9;/h9-10,15,17H,3-8H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | PYULLLVKJHZZTL-HNCPQSOCSA-N |
| XLogP | 1.64 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride?
The IUPAC name of 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride (CID 118295183) is 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride.
What is the SMILES notation for 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride?
The canonical SMILES for 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride is CC(C)(O)[C@H]1CC(F)(F)CN1C1CCNCC1.Cl.
What is the InChIKey of 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride?
The InChIKey is PYULLLVKJHZZTL-HNCPQSOCSA-N. The full InChI is InChI=1S/C12H22F2N2O.ClH/c1-11(2,17)10-7-12(13,14)8-16(10)9-3-5-15-6-4-9;/h9-10,15,17H,3-8H2,1-2H3;1H/t10-;/m1./s1.
What are the key properties of 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride?
2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride has a molecular weight of 284.78 g/mol, XLogP of 1.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]propan-2-ol;hydrochloride is sourced from PubChem (CID 118295183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).