About ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate
ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate (PubChem CID 118295496) has the molecular formula C12H15F3N2O4S
and a molecular weight of 340.32 g/mol. Its IUPAC name is ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate |
| PubChem CID | 118295496 |
| Molecular Formula | C12H15F3N2O4S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(S(=O)(=O)NC2CCC2(F)F)c1F |
| InChI | InChI=1S/C12H15F3N2O4S/c1-3-21-11(18)9-8(13)10(6(2)16-9)22(19,20)17-7-4-5-12(7,14)15/h7,16-17H,3-5H2,1-2H3 |
| InChIKey | OCNQORDSXJGPCQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate?
The IUPAC name of ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate (CID 118295496) is ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate?
The canonical SMILES for ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate is CCOC(=O)c1[nH]c(C)c(S(=O)(=O)NC2CCC2(F)F)c1F.
What is the InChIKey of ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate?
The InChIKey is OCNQORDSXJGPCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O4S/c1-3-21-11(18)9-8(13)10(6(2)16-9)22(19,20)17-7-4-5-12(7,14)15/h7,16-17H,3-5H2,1-2H3.
What are the key properties of ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate?
ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate has a molecular weight of 340.32 g/mol, XLogP of 1.71, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(2,2-difluorocyclobutyl)sulfamoyl]-3-fluoro-5-methyl-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 118295496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).