About ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate
ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate (PubChem CID 118296003) has the molecular formula C17H19ClN2O4
and a molecular weight of 350.80 g/mol. Its IUPAC name is ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate |
| PubChem CID | 118296003 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)cc1NCc1ccc(OC)cc1OC |
| InChI | InChI=1S/C17H19ClN2O4/c1-4-24-17(21)13-10-20-16(18)8-14(13)19-9-11-5-6-12(22-2)7-15(11)23-3/h5-8,10H,4,9H2,1-3H3,(H,19,20) |
| InChIKey | LHSIDRBREWDZLS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate?
The IUPAC name of ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate (CID 118296003) is ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate?
The canonical SMILES for ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate is CCOC(=O)c1cnc(Cl)cc1NCc1ccc(OC)cc1OC.
What is the InChIKey of ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate?
The InChIKey is LHSIDRBREWDZLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN2O4/c1-4-24-17(21)13-10-20-16(18)8-14(13)19-9-11-5-6-12(22-2)7-15(11)23-3/h5-8,10H,4,9H2,1-3H3,(H,19,20).
What are the key properties of ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate?
ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate has a molecular weight of 350.80 g/mol, XLogP of 3.54, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-chloro-4-[(2,4-dimethoxyphenyl)methylamino]pyridine-3-carboxylate is sourced from PubChem (CID 118296003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).