C19H25IO3 — CID 118296138
methyl 3-cyclopropyl-3-[3-[(3-iodocyclobutyl)methoxy]phenyl]-2-methylpropanoate (PubChem CID 118296138) has the molecular formula C19H25IO3 and a molecular weight of 428.31 g/mol. Its IUPAC name is methyl 3-cyclopropyl-3-[3-[(3-iodocyclobutyl)methoxy]phenyl]-2-methylpropanoate.
| Compound Name | methyl 3-cyclopropyl-3-[3-[(3-iodocyclobutyl)methoxy]phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 118296138 |
| Molecular Formula | C19H25IO3 |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | methyl 3-cyclopropyl-3-[3-[(3-iodocyclobutyl)methoxy]phenyl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)C(c1cccc(OCC2CC(I)C2)c1)C1CC1 |
| InChI | InChI=1S/C19H25IO3/c1-12(19(21)22-2)18(14-6-7-14)15-4-3-5-17(10-15)23-11-13-8-16(20)9-13/h3-5,10,12-14,16,18H,6-9,11H2,1-2H3 |
| InChIKey | FZIJRFYNXMMKCG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|