C21H27NO3 — CID 118296891
2-(2,6-diethyl-4-methylphenyl)-3-hydroxy-5-[(E)-methoxyiminomethyl]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one (PubChem CID 118296891) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-(2,6-diethyl-4-methylphenyl)-3-hydroxy-5-[(E)-methoxyiminomethyl]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one.
| Compound Name | 2-(2,6-diethyl-4-methylphenyl)-3-hydroxy-5-[(E)-methoxyiminomethyl]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one |
|---|---|
| PubChem CID | 118296891 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-(2,6-diethyl-4-methylphenyl)-3-hydroxy-5-[(E)-methoxyiminomethyl]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one |
| SMILES | CCc1cc(C)cc(CC)c1C1=C(O)C2CC(/C=N/OC)CC2C1=O |
| InChI | InChI=1S/C21H27NO3/c1-5-14-7-12(3)8-15(6-2)18(14)19-20(23)16-9-13(11-22-25-4)10-17(16)21(19)24/h7-8,11,13,16-17,23H,5-6,9-10H2,1-4H3/b22-11+ |
| InChIKey | XCRDIVBQBTTXPX-SSDVNMTOSA-N |
| XLogP | 4.25 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|