About 6-phenyl-2,3,4,5-tetrahydropyridine
6-phenyl-2,3,4,5-tetrahydropyridine (PubChem CID 11829725) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 6-phenyl-2,3,4,5-tetrahydropyridine.
Molecular Properties
| Compound Name | 6-phenyl-2,3,4,5-tetrahydropyridine |
| PubChem CID | 11829725 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 6-phenyl-2,3,4,5-tetrahydropyridine |
| SMILES | c1ccc(C2=NCCCC2)cc1 |
| InChI | InChI=1S/C11H13N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-3,6-7H,4-5,8-9H2 |
| InChIKey | XEJFZEYFXUTFPM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-phenyl-2,3,4,5-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-2,3,4,5-tetrahydropyridine?
The IUPAC name of 6-phenyl-2,3,4,5-tetrahydropyridine (CID 11829725) is 6-phenyl-2,3,4,5-tetrahydropyridine.
What is the SMILES notation for 6-phenyl-2,3,4,5-tetrahydropyridine?
The canonical SMILES for 6-phenyl-2,3,4,5-tetrahydropyridine is c1ccc(C2=NCCCC2)cc1.
What is the InChIKey of 6-phenyl-2,3,4,5-tetrahydropyridine?
The InChIKey is XEJFZEYFXUTFPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h1-3,6-7H,4-5,8-9H2.
What are the key properties of 6-phenyl-2,3,4,5-tetrahydropyridine?
6-phenyl-2,3,4,5-tetrahydropyridine has a molecular weight of 159.23 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-2,3,4,5-tetrahydropyridine is sourced from PubChem (CID 11829725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).