About 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine
2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine (PubChem CID 118297300) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine |
| PubChem CID | 118297300 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine |
| SMILES | NCC(c1cnco1)N1CCOCC1 |
| InChI | InChI=1S/C9H15N3O2/c10-5-8(9-6-11-7-14-9)12-1-3-13-4-2-12/h6-8H,1-5,10H2 |
| InChIKey | IYQHFMMRFLAAGB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine?
The IUPAC name of 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine (CID 118297300) is 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine.
What is the SMILES notation for 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine?
The canonical SMILES for 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine is NCC(c1cnco1)N1CCOCC1.
What is the InChIKey of 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine?
The InChIKey is IYQHFMMRFLAAGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c10-5-8(9-6-11-7-14-9)12-1-3-13-4-2-12/h6-8H,1-5,10H2.
What are the key properties of 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine?
2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine has a molecular weight of 197.24 g/mol, XLogP of 0.01, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine is sourced from PubChem (CID 118297300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).