C9H15N3O2 — CID 118297300
2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine (PubChem CID 118297300) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine.
| Compound Name | 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 118297300 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-morpholin-4-yl-2-(1,3-oxazol-5-yl)ethanamine |
| SMILES | NCC(c1cnco1)N1CCOCC1 |
| InChI | InChI=1S/C9H15N3O2/c10-5-8(9-6-11-7-14-9)12-1-3-13-4-2-12/h6-8H,1-5,10H2 |
| InChIKey | IYQHFMMRFLAAGB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |